2,2'-Anhydro-5'-O-DMT-5-methyluridine
2,2'-Anhydro-5'-O-DMT-5-methyluridine is a remarkable biomedicine agent having shown substantial efficacy in research of combating viral infections and specific neoplastic conditions. Unveiling its antiviral prowess against RNA viruses, this compound showcases a promising proclivity for impeding malignant tumor expansion.
| Supplier | BOC Sciences |
|---|---|
| Product # | 817623-11-3 |
| Pricing | Inquire |
| Cas | 817623-11-3 |
| Molecular Weight | 542.58 |
| Molecular Formula | C31H30N2O7 |
| Canonical SMILES | CC1=CN2C3C(C(C(O3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)O)OC2=NC1=O |