Z-LEU-ARG-7-AMINO-4-METHYLCOUMARIN
Z-Leu-Arg-7-Amino-4-Methylcoumarin is a fluorescent substrate for cathepsin L, S, and V, human tissue kallikrein and the falcipains I-III. It is the preferred substrate for falcipain II, a hemoglobin-degrading cysteine protease from Plasmodium falciparum, one of the most promising targets for antimalarial drug design. It is used to detect cathepsin K, an enzyme involved in osteoclast bone resorption.
| Supplier | BOC Sciences |
|---|---|
| Product # | 156192-32-4 |
| Pricing | Inquire |
| Cas | 156192-32-4 |
| Molecular Weight | 578.66 |
| Molecular Formula | C30H38N6O6 |
| Canonical SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)C(CCCN=C(N)N)NC(=O)C(CC(C)C)NC(=O)OCC3=CC=CC=C3 |