Asiatic acid
Asiatic acid is the aglycone of asiaticoside isolated from the plant Centella asiatica, commonly used in wound healing. Asiatic acid has the potential for skin cancer treatment. Asiatic acid also has anti-inflammatory activities.
Supplier | BOC Sciences |
---|---|
Product # | NP6983 |
Pricing | Inquire |
Cas | 464-92-6 |
Molecular Weight | 488.70 |
Molecular Formula | C30H48O5 |
Canonical SMILES | CC1CCC2(CCC3(C(=CCC4C3(CCC5C4(CC(C(C5(C)CO)O)O)C)C)C2C1C)C)C(=O)O |