2-Bromo-1-[4-(methylsulfonyl)phenyl]-1-ethanone
2-Bromo-1-[4-(methylsulfonyl)phenyl]-1-ethanone possesses significant utility within the biomedical field, particularly in the realm of disease therapeutics such as cancer and inflammation. Furthermore, its application extends to the innovative creation of targeted pharmaceutical agents tailored to distinct molecular routes, emphasizing its paramount significance in advancing medical treatments.
| Supplier | BOC Sciences |
|---|---|
| Product # | 50413-24-6 |
| Pricing | Inquire |
| Cas | 50413-24-6 |
| Molecular Weight | 277.13 |
| Molecular Formula | C9H9BrO3S |
| Canonical SMILES | CS(=O)(=O)C1=CC=C(C=C1)C(=O)CBr |