Lenoremycin sodium
It is a polyether antibiotic produced by the strain of Streptomyces hygroscopicus A-130. It has the effect of anti-gram-positive bacteria, mycobacterium and protozoa, and can be used as a feed additive to control Eimeriatenella infection.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-03029 |
| Pricing | Inquire |
| Cas | 58399-44-3 |
| Molecular Weight | 873.10 |
| Molecular Formula | C47H77NaO13 |
| Canonical SMILES | CC1CCC(OC12C(CC(O2)C3C(CC(C(O3)(CO)O)C)C)C)C4(CCC5(O4)C(C(CC(O5)C(C)C=C(C)C(=O)C(C)CC(C)C(=O)[O-])OC6CCC(C(O6)C)OC)C)C.[Na+] |