2'-Deoxy-5'-O-DMT-adenosine
2'-Deoxy-5'-O-DMT-adenosine is a potent nucleoside analog extensively used in the biomedical industry. With its ability to inhibit viral DNA synthesis, it serving as a key component in development of antiviral drugs. Its unique structure and mechanism make it a valuable tool for studying nucleic acid metabolism and developing targeted therapeutics.
| Supplier | BOC Sciences |
|---|---|
| Product # | 17331-22-5 |
| Pricing | Inquire |
| Cas | 17331-22-5 |
| Molecular Weight | 553.61 |
| Molecular Formula | C31H31N5O5 |
| Canonical SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)OCC4C(CC(O4)N5C=NC6=C(N=CN=C65)N)O |