Daunorubicin Impurity 2
Daunorubicin Impurity 2 is an impurity of Daunorubicin, which is an anthracycline antibiotic used in the treatment of acute myeloid and lymphocytic leukemia, with adverse reactions such as cardiotoxicity and bone marrow suppression.
| Supplier | BOC Sciences |
|---|---|
| Product # | 63700-24-3 |
| Pricing | Inquire |
| Cas | 63700-24-3 |
| Molecular Weight | 541.39 |
| Molecular Formula | C22H18F3N3O10 |
| Canonical SMILES | CC1C(C(CC(O1)OC(=O)C2=CC=C(C=C2)[N+](=O)[O-])NC(=O)C(F)(F)F)OC(=O)C3=CC=C(C=C3)[N+](=O)[O-] |