2,3-O-Isopropylidene-5-O-trityl-D-ribofuranose
2,3-O-Isopropylidene-5-O-trityl-D-ribofuranose, renowned for its indispensability in biomedicine and pharmaceutical research, plays a crucial role as a pivotal intermediate during the synthesis of antiviral drugs and nucleoside analogues. Its significance lies in serving as a foundational building block for the creation of nucleotide prodrugs, including potent antiretroviral agents, which exhibit remarkable efficacy in combatting viral infections such as HIV and hepatitis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 55726-19-7 |
| Pricing | Inquire |
| Cas | 55726-19-7 |
| Molecular Weight | 432.51 |
| Molecular Formula | C27H28O5 |
| Canonical SMILES | CC1(OC2C(OC(C2O1)O)COC(C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5)C |