Dapivirine-[d11]
Dapivirine-[d11], is the labelled analogue of Dapivirine. Dapivirine is a NNRTI for HIV reverse transcriptase with IC50 of 24 nM, inhibiting a broad panel of HIV-1 isolates from different classes, inclucing a wide range of NNRTI-resistant isolates.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-002430 |
| Pricing | Inquire |
| Cas | 1329613-10-6 |
| Molecular Weight | 340.47 |
| Molecular Formula | C20H8D11N5 |
| Canonical SMILES | CC1=CC(=C(C(=C1)C)NC2=NC(=NC=C2)NC3=CC=C(C=C3)C#N)C |