2'-Deoxy-5'-O-DMT-N6-phenoxyacetyladenosine
2'-Deoxy-5'-O-DMT-N6-phenoxyacetyladenosine is a highly potent compound utilized extensively within the biomedical sector, notably employed in discerning drug discovery and specialized therapeutic interventions. This instrumental entity boasts an intricate composition and inherent characteristics, rendering it invaluable for investigating the intricate functionality of adenosine receptors and their prospective manipulation in mitigating specific pathological conditions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 110522-82-2 |
| Pricing | Inquire |
| Cas | 110522-82-2 |
| Molecular Weight | 687.74 |
| Molecular Formula | C39H37N5O7 |
| Canonical SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)OCC4C(CC(O4)N5C=NC6=C(N=CN=C65)NC(=O)COC7=CC=CC=C7)O |