Lewis X trisaccharide
Lewis X trisaccharide, a pivotal molecule discovered in biomedicine, assumes a paramount position in the realm of immunotherapy, particularly in combating cancer. This trisaccharide demonstrates an inherent capacity to selectively impede the adhesion of malignant cells, thus propelling its potential as a formidable therapeutic agent, capable of addressing diverse forms of neoplastic maladies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 71208-06-5 |
| Pricing | Inquire |
| Cas | 71208-06-5 |
| Molecular Weight | 529.49 |
| Molecular Formula | C20H35NO15 |
| Canonical SMILES | CC1C(C(C(C(O1)OC(C(C=O)NC(=O)C)C(C(CO)O)OC2C(C(C(C(O2)CO)O)O)O)O)O)O |