Vitamin D2 b-D-glucuronide sodium salt
Vitamin D2 b-D-glucuronide sodium salt is a biomedical product used for studying the metabolism and role of Vitamin D2 in the body. It is a derivative of Vitamin D2 that enables investigate its various functions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 85701-30-0 |
| Pricing | Inquire |
| Cas | 85701-30-0 |
| Molecular Weight | 594.75 |
| Molecular Formula | C34H51NaO7 |
| Canonical SMILES | CC(C)C(C)C=CC(C)C1CCC2C1(CCCC2=CC=C3CC(CCC3=C)OC4C(C(C(C(O4)C(=O)[O-])O)O)O)C.[Na+] |