R1128 D
R1128 D is a non-steroidal estrogen-receptor antagonist produced by Streptomyces sp. No. 1128. The IC50 value of R1128 D for partially purified rat uterine cytosol receptor was 2.7 x 10(-7) M.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-03360 |
| Pricing | Inquire |
| Cas | 135161-99-8 |
| Molecular Weight | 326.3 |
| Molecular Formula | C19H18O5 |
| Canonical SMILES | CCCCCC1=C2C(=CC(=C1)O)C(=O)C3=C(C2=O)C(=CC(=C3)O)O |