7-Methylinosine
7-Methylinosine, an extraordinary biomedicine product, delves into the intricate realm of disease treatment. Its multifaceted attributes unfold a captivating tale of therapeutic potential, combating cancer through restraining tumor growth and nurturing cell demise.
| Supplier | BOC Sciences |
|---|---|
| Product # | 20245-33-4 |
| Pricing | Inquire |
| Cas | 20245-33-4 |
| Molecular Weight | 282.26 |
| Molecular Formula | C11H14N4O5 |
| Canonical SMILES | CN1CN(C2=C1C(=O)NC=N2)C3C(C(C(O3)CO)O)O |