4-Aminophenyl b-D-glucopyranoside
4-Aminophenyl b-D-glucopyranoside, a compound widely employed in the biomedical field as a biochemical, finds significant utility in scrutinizing the enzymatic hydrolysis of glucopyranosides. As a substrate, it propounds a cogent platform to explore catalytic activity of lysosomal enzymes and their role in glycogen degradation. Additionally, its potential has been uncovered in detecting certain maladies including Pompe disease.
| Supplier | BOC Sciences |
|---|---|
| Product # | 20818-25-1 |
| Pricing | Inquire |
| Cas | 20818-25-1 |
| Molecular Weight | 271.27 |
| Molecular Formula | C12H17NO6 |
| Canonical SMILES | C1=CC(=CC=C1N)OC2C(C(C(C(O2)CO)O)O)O |