2,3,4-Tri-O-acetyl-1-azido-1-deoxy-b-D-arabinopyranosyl cyanide
2,3,4-Tri-O-acetyl-1-azido-1-deoxy-b-D-arabinopyranosyl cyanide, a highly significant compound extensively utilized within the biomedical industry, assumes a pivotal function in the amalgamation of antiviral and antitumor medications. Its exceptional capacity to impede the proliferation of specific cancer cells imparts great importance to its presence. Moreover, this compound exhibits auspicious therapeutic capabilities against an array of afflictions, including viral infections and distinct cancer manifestations.
| Supplier | BOC Sciences |
|---|---|
| Product # | 168567-91-7 |
| Pricing | Inquire |
| Cas | 168567-91-7 |
| Molecular Weight | 326.26 |
| Molecular Formula | C12H14N4O7 |
| Canonical SMILES | CC(=O)OC1COC(C(C1OC(=O)C)OC(=O)C)(C#N)N=[N+]=[N-] |