H-Glu-Ala-Leu-Phe-Gln-pNA
The substrate EALFQ-pNA representing the 2C/3A cleavage site of human rhinovirus-14 (HRV-14) polyprotein is hydrolyzed by human rhinovirus-14 3C protease, which is an attractive target for antiviral drug development. It shows a kcat/Km value of 840 M-1s-1.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-015067 |
| Pricing | Inquire |
| Cas | 198551-00-7 |
| Molecular Weight | 726.78 |
| Molecular Formula | C34H46N8O10 |
| Canonical SMILES | CC(C)CC(C(=O)NC(CC1=CC=CC=C1)C(=O)NC(CCC(=O)N)C(=O)NC2=CC=C(C=C2)[N+](=O)[O-])NC(=O)C(C)NC(=O)C(CCC(=O)O)N |