Potassium m-tolyltrifluoroborate
Potassium m-tolyltrifluoroborate is a prominent compound in the biomedical industry and serves as a crucial reagent in diverse chemical reactions, thus facilitating the synthesis of potential pharmaceutical entities. Its multifaceted utility elevates its significance in medicinal chemistry, particularly in the pursuit of innovative therapeutic agents against ailments like cancer, inflammation, and microbial infections.
Supplier | BOC Sciences |
---|---|
Product # | 850623-42-6 |
Pricing | Inquire |
Cas | 850623-42-6 |
Molecular Weight | 198.03 |
Molecular Formula | C7H7BF3K |
Canonical SMILES | [B-](C1=CC(=CC=C1)C)(F)(F)F.[K+] |