CMP-5
CMP5 is a potent, selective and specific inhibitor of PRMT5, but has no activity against PRMT1, PRMT4 and PRMT7 enzymes. CMP5 selectively blocks S2Me-H4R3 by inhibiting the activity of PRMT5 methyltransferase on histone preparations. It prevents epstein-barr virus (EBV)-driven B-lymphocyte transformation, but does not affect normal B cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 880813-42-3 |
| Pricing | Inquire |
| Cas | 880813-42-3 |
| Molecular Weight | 315.41 |
| Molecular Formula | C21H21N3 |
| Canonical SMILES | CCN1C2=C(C=C(C=C2)CNCC3=CC=CC=N3)C4=CC=CC=C41 |