Viral-2C-protein-inhibitor-1
Viral 2C protein inhibitor 1 (compound 6aw) is a potent and broad-spectrum enterovirus antiviral agent, inhibiting viral 2C
protein. Viral 2C protein inhibitor 1 inhibits multiple strains of EV-D68, EV-A71 and CVB3 with EC50s of 0.1~3.6 µM, and
exhibits high selectivity index and relatively low cytotoxicity
protein. Viral 2C protein inhibitor 1 inhibits multiple strains of EV-D68, EV-A71 and CVB3 with EC50s of 0.1~3.6 µM, and
exhibits high selectivity index and relatively low cytotoxicity
| Supplier | BOC Sciences |
|---|---|
| Product # | 1594427-18-5 |
| Pricing | Inquire |
| Cas | 1594427-18-5 |
| Molecular Weight | 323.36 |
| Molecular Formula | C19H18FN3O |
| Canonical SMILES | CNCCNC(=O)C1=CC(=NC2=CC=CC=C21)C3=CC=C(C=C3)F |