Chrysomycin B
Chrysomycin B is a minor analogue in a complex of C-glycoside antitumor active substances isolated from Streptomyces. Its activity is lower than that of its vinyl analogue (Chrysomycin A), but it still has strong anti-tumor activity and is an inhibitor of the catalytic activity of human topoisomerase II. It can be used as a light-activated cross-linking agent for DNA and histones.
| Supplier | BOC Sciences |
|---|---|
| Product # | 83852-56-6 |
| Pricing | Inquire |
| Cas | 83852-56-6 |
| Molecular Weight | 496.50 |
| Molecular Formula | C27H28O9 |
| Canonical SMILES | CC1C(C(C(C(O1)C2=C3C(=C(C=C2)O)C(=CC4=C3OC(=O)C5=C4C(=CC(=C5)C)OC)OC)O)(C)O)O |