Taikuguasin D
Taikuguasin D, a pinnacle of biomedicine, is composed of active compounds that restrain the growth of leukemia cells by targeting specific proteins. As the cells undergo programmed death, this wonderment exhibits a potential therapy for leukemia. In preclinical studies, Taikuguasin D manifested promising results, captivating the attention of experts for further development.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP7120 |
| Pricing | Inquire |
| Cas | 1627163-80-7 |
| Molecular Weight | 648.88 |
| Molecular Formula | C37H60O9 |
| Canonical SMILES | OCC1OC(OC(C=C(C)C)CC(C)C2CCC3(C)C4C=CC56OC(OC)C4(CCC23C)C6CCC(O)C5(C)C)C(O)C(O)C1O |