Cletoquine-d4
Cletoquine-d4 is deuterium labeled Cletoquine. Cletoquine (Desethylhydroxychloroquine) is a major active metabolite o Hydroxychloroquine. Cletoquine is produced in the liver by CYP2D6, CYP3A4, CYP3A5, and CYP2C8 isoenzymes. Cletoquine is also a Chloroquine derivative and has the ability to against the chikungunya virus (CHIKV). Cletoquine has antimalarial effects and has the potential for autoimmune diseases treatmen.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1854126-47-8 |
| Pricing | Inquire |
| Cas | 1854126-47-8 |
| Molecular Weight | 311.84 |
| Molecular Formula | C16H22ClN3O |
| Canonical SMILES | CC(CCCNCCO)NC1=C2C=CC(=CC2=NC=C1)Cl |