Phochinenin G
Phochinenin G is a natural compound utilized in the research of various forms of cancer, such as breast, lung and colorectal cancer. This product harnesses its targeted properties to inhibit tumor growth and promote apoptosis.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP5015 |
| Pricing | Inquire |
| Cas | 1070883-75-8 |
| Molecular Weight | 482.52 |
| Molecular Formula | C30H26O6 |
| Canonical SMILES | COC1=CC2=C(C3=CC(=C(C=C3CC2)O)C4=C(C=C5CCC6=C(C5=C4O)C=CC(=C6)O)OC)C(=C1)O |