Aureusimine B
It is an inhibitor of the protease Calpain produced by the strain of Streptomyces sp. SC433. It is a small molecular weight monoketopiperazine formed non-ribosomally by the fusion of phenylalanine and valin.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-04198 |
| Pricing | Inquire |
| Cas | 170713-71-0 |
| Molecular Weight | 228.29 |
| Molecular Formula | C14H16N2O |
| Canonical SMILES | CC(C)C1=NC=C(NC1=O)CC2=CC=CC=C2 |