1-(2-Deoxy-5-O-MMT-b-D-threo-pentofuranosyl)-5-fluorouracil
1-(2-Deoxy-5-O-MMT-b-D-threo-pentofuranosyl)-5-fluorouracil, commonly known as 5-FU, holds paramount significance in the realm of biomedicine. This intricate compound has garnered substantial attention due to its immense potential as an antineoplastic agent, with a specific focus on combatting colorectal, breast, and head and neck cancers. Through its ability to impede DNA synthesis and stimulate apoptotic processes in malignant cells, this compound showcases remarkable cytotoxic effects. Its extraordinary structure and mechanism render it an invaluable asset in the pursuit of cancer therapy research.
| Supplier | BOC Sciences |
|---|---|
| Product # | 121353-92-2 |
| Pricing | Inquire |
| Cas | 121353-92-2 |
| Molecular Weight | 518.53 |
| Molecular Formula | C29H27FN2O6 |
| Canonical SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)OCC4C(CC(O4)N5C=C(C(=O)NC5=O)F)O |