5'-O-DMT-N4-Ac-2'-O-(2-methoxyethyl)cytidine
5'-O-DMT-N4-Ac-2'-O-(2-methoxyethyl)cytidine is a modified cytidine nucleoside used in oligonucleotide synthesis. It features a cytidine base with an N4-acetyl modification and a 2'-O-(2-methoxyethyl) group attached to the ribose sugar moiety. This modification enhances the stability and specificity of the resulting oligonucleotides, making them valuable tools in various molecular biology applications.
| Supplier | BOC Sciences |
|---|---|
| Product # | BRP-00744 |
| Pricing | Inquire |
| Cas | 1345716-47-3 |
| Molecular Weight | 645.71 |
| Molecular Formula | C35H39N3O9 |
| Canonical SMILES | O=C1N=C(C=CN1C2OC(COC(C=3C=CC=CC3)(C4=CC=C(OC)C=C4)C5=CC=C(OC)C=C5)C(O)C2OCCOC)NC(=O)C |