L-Glutamine α-tert-butyl ester hydrochloride
L-Glutamine tert-butyl ester hydrochloride is a protected form of L-Glutamine. L-Glutamine is a non-essential amino acid that is important for cells that proliferate quickly in the body, such as those of the immune system. L-Glutamine is known to be especially important for the gut, as it helps maintain intestinal structure and function. L-Glutamine also has protective properties against host toxicity of chemotherapy in cancer patients.
| Supplier | BOC Sciences |
|---|---|
| Product # | 39741-62-3 |
| Pricing | Inquire |
| Cas | 39741-62-3 |
| Molecular Weight | 238.72 |
| Molecular Formula | C9H18N2O3·HCl |
| Canonical SMILES | CC(C)(C)OC(=O)C(CCC(=O)N)N.Cl |