Sorafenib-[d4]
Sorafenib-[d4] is the labelled analogue of Sorafenib. Sorafenib is a small inhibitor of several tyrosine protein kinases, such as VEGFR, PDGFR and Raf family kinases, for the treatment of primary kidney cancer, advanced primary liver cancer and radioactive iodine resistant advanced thyroid carcinoma.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-012589 |
| Pricing | Inquire |
| Cas | 1207560-07-3 |
| Molecular Weight | 468.85 |
| Molecular Formula | C21H12D4ClF3N4O3 |
| Canonical SMILES | CNC(=O)C1=NC=CC(=C1)OC2=CC=C(C=C2)NC(=O)NC3=CC(=C(C=C3)Cl)C(F)(F)F |