ADP-D-glucose disodium salt
ADP-D-glucose disodium salt is a fundamental recompound, presenting an exceptional avenue for delving into the intricate intricacies of glucose metabolism. This utmost pivotal compound operates as a substrate for the enzymes that actively partake in glycosylation procedures as well as the bioresearch and development of glycogen and starch.
| Supplier | BOC Sciences |
|---|---|
| Product # | 102129-65-7 |
| Pricing | Inquire |
| Cas | 102129-65-7 |
| Molecular Weight | 633.31 |
| Molecular Formula | C16H23N5O15P2.2Na |
| Canonical SMILES | C1=NC(=C2C(=N1)N(C=N2)C3C(C(C(O3)COP(=O)([O-])OP(=O)([O-])OC4C(C(C(C(O4)CO)O)O)O)O)O)N.[Na+].[Na+] |