Fusidate sodium
Sodium fusidate is a bacteriostatic antibiotic isolated from the fermentation broth of Fusidium coccineum. It suppresses nitric oxide lysis of pancreatic islet cells. It also inhibits protein synthesis in prokaryotes by inhibiting the ribosome-dependent activity of G factor and translocation of peptidyl-tRNA. It is also used to inhibit the replication of gram-positive bacteria including Staphylococcus, Streptococcus, and Corynebacterium species.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-03944 |
| Pricing | Inquire |
| Cas | 751-94-0 |
| Molecular Weight | 538.70 |
| Molecular Formula | C31H47NaO6 |
| Canonical SMILES | CC1C2CCC3(C(C2(CCC1O)C)C(CC4C3(CC(C4=C(CCC=C(C)C)C(=O)[O-])OC(=O)C)C)O)C.[Na+] |