4-Acetylbenzenesulfonyl chloride
4-Acetylbenzenesulfonyl chloride (CAS# 1788-10-9) is used as one of the substances for mutagenic and carcinogenic risk assessment of carboxylic and sulfonic acid halides as drug impurities. Also, acts as a reagent for the synthesis of (+)-Dehydroabietylamine derivatives which are targeted for triple-negative breast cancer treatment.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1788-10-9 |
| Pricing | Inquire |
| Cas | 1788-10-9 |
| Molecular Weight | 218.66 |
| Molecular Formula | C8H7ClO3S |
| Canonical SMILES | CC(=O)C1=CC=C(C=C1)S(=O)(=O)Cl |