Etheno-ADP (ε-ADP)
Etheno-ADP, a synthetic analogue of adenosine diphosphate (ADP), is commonly employed in biochemical research to track cellular processes. Notably, it enables insightful investigations into ATP-fueled events such as muscle contraction, alongside enzyme-catalyzed reactions implicated in DNA replication and repair. Moreover, Etheno-ADP holds encouraging potential as a chemotherapeutic agent for various cancers, and preliminary findings suggest its value in neurological studies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 38806-39-2 |
| Pricing | Inquire |
| Cas | 38806-39-2 |
| Molecular Weight | 451.03 (free acid) |
| Molecular Formula | C12H15N5O10P2(free acid) |
| Canonical SMILES | C1=CN2C=NC3=C(C2=N1)N=CN3C4C(C(C(O4)COP(=O)(O)OP(=O)(O)O)O)O |