3',5'-O-(1,1,3,3-Tetraisopropyl-1,3-disiloxanediyl)-5-methyluridine
3',5'-O-(1,1,3,3-Tetraisopropyl-1,3-disiloxanediyl)-5-methyluridine, a remarkably powerful biomedicine, is harnessed in the treatment of an array of afflictions. Unearthed on diverse biomedical platforms, this compound unfurls unparalleled therapeutic potential in vanquishing cancer, combating viral infections, and mitigating genetic disorders. Its profound mechanism revolves around meticulously targeting and steering distinct cellular pathways, paving the way for gene expression modulation, viral replication inhibition, and impeding tumor proliferation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 130983-87-8 |
| Pricing | Inquire |
| Cas | 130983-87-8 |
| Molecular Weight | 500.73 |
| Molecular Formula | C22H40N2O7Si2 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2C(C3C(O2)CO[Si](O[Si](O3)(C(C)C)C(C)C)(C(C)C)C(C)C)O |