2,2'-Anhydro-6-methoxycarbonyl-b-D-arabinofuranosyl uracil
2,2'-Anhydro-6-methoxycarbonyl-b-D-arabinofuranosyl uracil (AMFU) emerges as a pivotal constituent within the biomedical domain. Its indispensability lies in combating an array of viral diseases with utmost efficacy. AMFU, a profound antiviral entity, exhibits exceptional efficacy against DNA viruses, including the notorious herpes strain. This remarkable compound operates by meticulously inhibiting the replication and dissemination of viral DNA, presenting a promising therapeutic avenue to actively combat the virus-inflicted maladies plaguing society.
| Supplier | BOC Sciences |
|---|---|
| Product # | 36963-58-3 |
| Pricing | Inquire |
| Cas | 36963-58-3 |
| Molecular Weight | 284.22 |
| Molecular Formula | C11H12N2O7 |
| Canonical SMILES | COC(=O)C1=CC(=O)N=C2N1C3C(O2)C(C(O3)CO)O |