Virginiamycin S2
It is a depsipeptide antibiotic produced by the strain of Str. virginiae and Str. virginiae var. sp. It has anti-gram-positive bacteria and mycobacterium effects, and the antibacterial activity of component M of Virginiamycin against cocci is stronger than component S, while the activity is stronger than component M.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02966 |
| Pricing | Inquire |
| Cas | 33477-38-2 |
| Molecular Weight | 811.88 |
| Molecular Formula | C42H49N7O10 |
| Canonical SMILES | CCC1C(=O)N2CCCC2C(=O)NC(C(=O)N3CCC(CC3C(=O)NC(C(=O)OC(C(C(=O)N1)NC(=O)C4=C(C=CC=N4)O)C)C5=CC=CC=C5)O)CC6=CC=CC=C6 |