Dovitinib Dilactic Acid
Dovitinib is a multitargeted RTK inhibitor, mostly for class III (FLT3/c-Kit) with IC50 of 1 nM/2 nM, also potent to class IV (FGFR1/3) and class V (VEGFR1-4) RTKs with IC50 of 8-13 nM, less potent to InsR, EGFR, c-Met, EphA2, Tie2, IGF-1R and HER2 in cell-free assays.
| Supplier | BOC Sciences |
|---|---|
| Product # | 852433-84-2 |
| Pricing | Inquire |
| Cas | 852433-84-2 |
| Molecular Weight | 572.59 |
| Molecular Formula | C27H33FN6O7 |
| Canonical SMILES | CC(C(=O)O)O.CC(C(=O)O)O.CN1CCN(CC1)C2=CC3=C(C=C2)NC(=C4C(=C5C(=NC4=O)C=CC=C5F)N)N3 |