3'-Deoxy-3-deazauridine
3'-Deoxy-3-deazauridine is a distinguished pharmaceutical compound with remarkable therapeutic value, finding its indispensable application in research of viral infections. Tailored specifically for RNA viruses research, including the treacherous hepatitis C and the notorious flaviviruses such as dengue, this exquisite compound exhibits efficacy by flawlessly thwarting viral replication and subduing enhancement of viral RNA.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2095417-74-4 |
| Pricing | Inquire |
| Cas | 2095417-74-4 |
| Molecular Weight | 227.21 |
| Molecular Formula | C10H13NO5 |
| Canonical SMILES | C1C(OC(C1O)N2C=CC(=CC2=O)O)CO |