18:1 Lyso PI ammonium salt
18:1 Lyso PI ammonium salt is used in biomedical research for studying lipid metabolism and signaling pathways. It is commonly used as a substrate for enzymes involved in the synthesis and degradation of phosphatidylinositol species, which play crucial roles in cell signaling and membrane trafficking.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1246298-13-4 |
| Pricing | Inquire |
| Cas | 1246298-13-4 |
| Molecular Weight | 615.69 |
| Molecular Formula | C27H54NO12P |
| Canonical SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OC1C(C(C(C(C1O)O)O)O)O)O.N |