Lavendustin B
Lavendustin B is a competitive inhibitor of glucose transporter 1 (Glut1), and also an inhibitor of the interaction between HIV-1 integrase and LEDGF/p75. It can be used as a negative control of Lavendustin A.
| Supplier | BOC Sciences |
|---|---|
| Product # | 125697-91-8 |
| Pricing | Inquire |
| Cas | 125697-91-8 |
| Molecular Weight | 365.38 |
| Molecular Formula | C21H19NO5 |
| Canonical SMILES | C1=CC=C(C(=C1)CN(CC2=CC=CC=C2O)C3=CC(=C(C=C3)O)C(=O)O)O |