5-O-Methylvisamminol
5-O-Methylvisamminol is an intriguing and formidable compound emerging from the depths of nature, possessing magnificent antitumor prowess. Astonishingly, this enigmatic natural compound is also used to study the perils of inflammatory afflictions and perturbations within the immune system.
| Supplier | BOC Sciences |
|---|---|
| Product # | 80681-42-1 |
| Pricing | Inquire |
| Cas | 80681-42-1 |
| Molecular Weight | 290.31 |
| Molecular Formula | C16H18O5 |
| Canonical SMILES | CC1=CC(=O)C2=C(C3=C(C=C2O1)OC(C3)C(C)(C)O)OC |