Cyclothialidine D
It is produced by the strain of Streptomyces sp. NR 0659. It and its homologues inhibit escherichia coli DNA helicases with IC50 of 0.7 μmol/L, and the reference neomycin was 1.2 μmol/L.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-01121 |
| Pricing | Inquire |
| Cas | 194276-78-3 |
| Molecular Weight | 597.60 |
| Molecular Formula | C24H31N5O11S |
| Canonical SMILES | CC(C(=O)N1CCC(C1C(=O)NC2COC(=O)C3=C(CSCC(NC2=O)C(=O)NCC(=O)O)C(=CC(=C3)O)O)O)N |