(R)-5'-O-[Bis(4-methoxyphenyl)phenylmethyl]-2'-O-(2-methoxyethyl)-5-methyluridine 3'-[2-cyanoethyl bis(1-methylethyl)phosphoramidite]
(R)-5'-O-[Bis(4-methoxyphenyl)phenylmethyl]-2'-O-(2-methoxyethyl)-5-methyluridine 3'-[2-cyanoethyl bis(1-methylethyl)phosphoramidite]: an essential compound in the pharmaceutical industry, utilized for oligonucleotide synthesis to combat a range of diseases. During the synthetic process, it serves as a phosphoramidite building block, modifying the DNA or RNA structure for enhanced therapeutic efficacy. This chemical compound is of immense value to the medical community for its unparalleled benefits.
| Supplier | BOC Sciences |
|---|---|
| Product # | 163759-51-1 |
| Pricing | Inquire |
| Cas | 163759-51-1 |
| Molecular Weight | 818.9 |
| Molecular Formula | C43H55N4O10P |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2C(C(C(O2)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC)OP(N(C(C)C)C(C)C)OCCC#N)OCCOC |