5-Benzylaminocarbonyl-3'-O-acetyl-2'-O-methyluridine
5-Benzylaminocarbonyl-3'-O-acetyl-2'-O-methyluridine, an essential compound in the biomedical field, possesses a distinctive chemical configuration, rendering it indispensable for the advancement of antiviral medications specifically designed for RNA viruses. By impeding the replication mechanisms of select viruses such as influenza and hepatitis C, this compound exhibits encouraging outcomes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2095417-64-2 |
| Pricing | Inquire |
| Cas | 2095417-64-2 |
| Molecular Weight | 433.41 |
| Molecular Formula | C20H23N3O8 |
| Canonical SMILES | CC(=O)OC1C(OC(C1OC)N2C=C(C(=O)NC2=O)C(=O)NCC3=CC=CC=C3)CO |