Abz-(Asn670,Leu671)-Amyloid β/A4 Protein Precursor770 (669-674)-EDDnp
Abz-(Asn670,Leu671)-Amyloid β/A4 Protein Precursor770 (669-674)-EDDnp is an intramolecularly quenched fluorescent substrate with the ortho-aminobenzoyl (Abz)/N-(2,4-dinitrophenyl)ethylenediamine (EDDnp) groups as the donor/acceptor pair. It corresponds to the Swedish-mutated (JMV2236) β-amyloid precursor protein (βAPP) sequence, which is targeted by β-secretase BACE (β-site APP-cleaving activity). It is more selectively cleaved by BACE1 and BACE2 than by cathepsin D, a disintegrin and metalloprotease 10 (ADAM10), tumor necrosis α-converting enzyme (TACE), presenilin-1 (PS1), or presenilin-2 (PS2).
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-014531 |
| Pricing | Inquire |
| Cas | 1007306-20-8 |
| Molecular Weight | 986.99 |
| Molecular Formula | C42H58N12O16 |
| Canonical SMILES | CC(C)CC(C(=O)NC(CC(=O)O)C(=O)NC(C)C(=O)NC(CCC(=O)O)C(=O)NCCNC1=C(C=C(C=C1)[N+](=O)[O-])[N+](=O)[O-])NC(=O)C(CC(=O)N)NC(=O)C(C(C)C)NC(=O)C2=CC=CC=C2N |