4-Benzyloxy-1-tert-butoxycarbonylindole-2-boronic acid
4-Benzyloxy-1-tert-butoxycarbonylindole-2-boronic acid is a distinctive compound employed in the biomedical field with a remarkable chemical framework. Renowned for its efficacy, this compound holds promise in the creation of remedies for diverse ailments. Be it cancer, inflammation, or neurological disorders, this versatile substance offers a valuable solution. In the realm of biomedicine research, it serves as an indispensable facilitator, empowering scientists to unfold groundbreaking therapeutic approaches.
| Supplier | BOC Sciences |
|---|---|
| Product # | 850568-52-4 |
| Pricing | Inquire |
| Cas | 850568-52-4 |
| Molecular Weight | 367.2 |
| Molecular Formula | C20H22BNO5 |
| Canonical SMILES | B(C1=CC2=C(N1C(=O)OC(C)(C)C)C=CC=C2OCC3=CC=CC=C3)(O)O |