Takanawaene B
Takanawaene B is a pentaene macrolide antibiotic produced by Streptomyces sp. K99-5278. It has the activity of inhibiting the growth of Aspergillus niger, Mucor raceme, Candida albicans and Saccharomyces cerevisiae, with IC50 of 0.94, 44.3, 177.0 and 20.9 µmol/L, respectively.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-03098 |
| Pricing | Inquire |
| Cas | 627509-57-3 |
| Molecular Weight | 564.75 |
| Molecular Formula | C32H52O8 |
| Canonical SMILES | CCC1C(C=CC=CC=CC=CC=CC(C(C(CC(CC(CCCC(CC(C(C(=O)O1)C)O)O)O)O)O)C)O)C |