1-Adamantanamine sulfate
Amantadine (1-Adamantanamine) sulfate is an orally avtive and potent antiviral agent with activity against influenza A viruses. Amantadine sulfate inhibits several ion channels such as NMDA and M2, and also inhibits Coronavirus ion channels. It also has anti-orthopoxvirus and anticancer activity. Amantadine sulfate can be used for Parkinson's disease, postoperative cognitive dysfunction (POCD) and COVID-19 research.
| Supplier | BOC Sciences |
|---|---|
| Product # | 31377-23-8 |
| Pricing | Inquire |
| Cas | 31377-23-8 |
| Molecular Weight | 249.32 |
| Molecular Formula | C10H17N.H2SO4 |
| Canonical SMILES | C1C2CC3CC1CC(C2)(C3)N.OS(=O)(=O)O |