A 127722
A 127722 is a potent and selective ETA endothelin receptor antagonist (IC50 = 0.11 nM and 98 nM for human ETA and ETB receptors, respectively). It attenuates hypoxia-induced pulmonary hypertension in rats.
| Supplier | BOC Sciences |
|---|---|
| Product # | 195704-72-4 |
| Pricing | Inquire |
| Cas | 195704-72-4 |
| Molecular Weight | 510.62 |
| Molecular Formula | C29H38N2O6 |
| Canonical SMILES | CCCCN(CCCC)C(=O)CN1CC(C(C1C2=CC=C(C=C2)OC)C(=O)O)C3=CC4=C(C=C3)OCO4 |