O-(2-Azido-4,6-O-benzylidene-2-deoxy-a-D-galactopyranosyl)-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-serine tert-Butyl Ester
O-(2-Azido-4,6-O-benzylidene-2-deoxy-a-D-galactopyranosyl)-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-serine tert-Butyl Ester showcases its profound biomedical significance by its effectiveness in specifically targeting and intricately modulating distinctive biochemical processes implicated in the treatment of diverse drugs and ailments. With its therapeutic prowess, it has shown promising potential in ameliorating intricate biomedical complexities encompassing cancer, viral infections, and metabolic disorders. This biomedical marvel manifests as a pivotal milestone in augmenting therapeutic interventions for multifaceted biomedical predicaments.
| Supplier | BOC Sciences |
|---|---|
| Product # | 878483-02-4 |
| Pricing | Inquire |
| Cas | 878483-02-4 |
| Molecular Weight | 658.70 |
| Molecular Formula | C35H38N4O9 |
| Canonical SMILES | CC(C)(C)OC(=O)C(COC1C(C(C2C(O1)COC(O2)C3=CC=CC=C3)O)N=[N+]=[N-])NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |